Products 2287263-30-1
CAS 2287263-30-1 is the registry number for 4-Methoxy-7-methyl-2,3-dihydro-1H-indole-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-methoxy-7-methyl-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride (CAS 2287263-30-1) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: 4-methoxy-7-methyl-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride. InChIKey: KFMWUUMIGQUGSV-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | 4-methoxy-7-methyl-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride |
| InChIKey | KFMWUUMIGQUGSV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)OC)CC(N2)C(=O)O.Cl |
Computed by PubChem (NCBI)