CAS 2287268-52-2 is the registry number for 1-Benzyl-2,2-dimethylcyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-benzyl-2,2-dimethylcyclopropan-1-amine;hydrochloride (CAS 2287268-52-2) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 1-benzyl-2,2-dimethylcyclopropan-1-amine;hydrochloride. InChIKey: FXKPSMOIWDFMBK-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 1-benzyl-2,2-dimethylcyclopropan-1-amine;hydrochloride |
| InChIKey | FXKPSMOIWDFMBK-UHFFFAOYSA-N |
| SMILES | CC1(CC1(CC2=CC=CC=C2)N)C.Cl |
Computed by PubChem (NCBI)