Products 2287346-10-3
CAS 2287346-10-3 is the registry number for (3R,4S)-4-Isobutyl-3-(methoxymethoxy)-1-(4-methoxyphenyl)azetidin-2-one, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, 1g, 250mg, on request.
(3R,4S)-3-(methoxymethoxy)-1-(4-methoxyphenyl)-4-(2-methylpropyl)azetidin-2-one (CAS 2287346-10-3) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (3R,4S)-3-(methoxymethoxy)-1-(4-methoxyphenyl)-4-(2-methylpropyl)azetidin-2-one. InChIKey: JCNAJUYJYMZUBH-LSDHHAIUSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (3R,4S)-3-(methoxymethoxy)-1-(4-methoxyphenyl)-4-(2-methylpropyl)azetidin-2-one |
| InChIKey | JCNAJUYJYMZUBH-LSDHHAIUSA-N |
| SMILES | CC(C)C[C@H]1[C@H](C(=O)N1C2=CC=C(C=C2)OC)OCOC |
Computed by PubChem (NCBI)