Products 22895-19-8
CAS 22895-19-8 is the registry number for DIMETHYL 4-METHOXYPHTHALATE, >=97.0% &. Offered by: Sigma-Aldrich. Available pack sizes: 10ML.
Dimethyl 4-methoxybenzene-1,2-dicarboxylate (CAS 22895-19-8) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: dimethyl 4-methoxybenzene-1,2-dicarboxylate. InChIKey: WKSKDXDNBSJCIM-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | dimethyl 4-methoxybenzene-1,2-dicarboxylate |
| InChIKey | WKSKDXDNBSJCIM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 4-methoxyphthalate, Dimethyl 4-methoxybenzene-1,2-dicarboxylate, 4-methoxyphthalic acid dimethyl ester, 1,2-Benzenedicarboxylic acid, 4-methoxy-, 1,2-dimethyl ester, 1,2-Benzenedicarboxylic acid, 4-methoxy-, dimethyl ester, 4-Methoxy-phthalic acid dimethyl ester, methyl 5-methoxy-2-(methoxycarbonyl)benzoate, Dimethyl 4-methoxyphthalate, >=97.0% (GC), Benzene-1,2-dicarboxylic acid, 4-methoxy, dimethyl ester