Products 229028-67-5

CAS 229028-67-5 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}-3-cyanopropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 229028-67-5) is a chemical compound with the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. IUPAC name: 3-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: IVKMLPKBZQTAMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14N2O4
Molecular weight214.22 g/mol
IUPAC name3-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
InChIKeyIVKMLPKBZQTAMQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC#N)C(=O)O

Computed by PubChem (NCBI)