Products 2291165-09-6
CAS 2291165-09-6 is the registry number for (5-(Ethoxycarbonyl)-6-methylpyridin-3-yl)boronic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
(5-ethoxycarbonyl-6-methyl-3-pyridinyl)boronic acid (CAS 2291165-09-6) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: (5-ethoxycarbonyl-6-methyl-3-pyridinyl)boronic acid. InChIKey: ZFUXYKZIOGGVEB-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | (5-ethoxycarbonyl-6-methyl-3-pyridinyl)boronic acid |
| InChIKey | ZFUXYKZIOGGVEB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)