CAS 138125-72-1 appears in our catalog under these names: rel-m-nitro-threo-Chloramphenicol, threo-m-Chloramphenicol (mixture of enantiomers), threo-m-Chloramphenicol (mixture of enantiomers), Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 100mg, 50mg, 25mg, 1x10mg, 1x1ml.
2,2-dichloro-N-[(1S,2S)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide (CAS 138125-72-1) is a chemical compound with the molecular formula C11H12Cl2N2O5 and a molecular weight of 323.13 g/mol. IUPAC name: 2,2-dichloro-N-[(1S,2S)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide. InChIKey: FTMJFHVKAXPFIY-IUCAKERBSA-N.
| Molecular formula | C11H12Cl2N2O5 |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1S,2S)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide |
| InChIKey | FTMJFHVKAXPFIY-IUCAKERBSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])[C@@H]([C@H](CO)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)