CAS 22955-73-3 appears in our catalog under these names: Dimethyl 4–methoxyisophthalate, Dimethyl 4-methoxyisophthalate 95+%, Dimethyl 4-methoxyisophthalate, 97%, 97%, Dimethyl 4-methoxyisophthalate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
Dimethyl 4-methoxybenzene-1,3-dicarboxylate (CAS 22955-73-3) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: dimethyl 4-methoxybenzene-1,3-dicarboxylate. InChIKey: VYLTWLWJTAJDSS-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | dimethyl 4-methoxybenzene-1,3-dicarboxylate |
| InChIKey | VYLTWLWJTAJDSS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)