CAS 2295828-32-7 is the registry number for (4R)-4-Propyl-L-proline Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(2S,4R)-4-propylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 2295828-32-7) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: (2S,4R)-4-propylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: TXAPCOQNEYUROQ-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | (2S,4R)-4-propylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | TXAPCOQNEYUROQ-HHQFNNIRSA-N |
| SMILES | CCC[C@@H]1C[C@H](NC1)C(=O)O.Cl |
Computed by PubChem (NCBI)