CAS 229648-45-7 is the registry number for Methyl 4-(isopropylcarbamoyl)benzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
Methyl 4-(propan-2-ylcarbamoyl)benzoate (CAS 229648-45-7) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: methyl 4-(propan-2-ylcarbamoyl)benzoate. InChIKey: YDJNKBLBCLNXJY-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | methyl 4-(propan-2-ylcarbamoyl)benzoate |
| InChIKey | YDJNKBLBCLNXJY-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)