CAS 22966-11-6 appears in our catalog under these names: 2-Chlorochalcone, 95%, (E)-3-(2-Chlorophenyl)-1-phenylprop-2-en-1-one 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg.
(E)-3-(2-chlorophenyl)-1-phenylprop-2-en-1-one (CAS 22966-11-6) is a chemical compound with the molecular formula C15H11ClO and a molecular weight of 242.70 g/mol. IUPAC name: (E)-3-(2-chlorophenyl)-1-phenylprop-2-en-1-one. InChIKey: IGSYOTSSTZUGIA-ZHACJKMWSA-N.
| Molecular formula | C15H11ClO |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | (E)-3-(2-chlorophenyl)-1-phenylprop-2-en-1-one |
| InChIKey | IGSYOTSSTZUGIA-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)