CAS 956-02-5 appears in our catalog under these names: 4'-Chlorochalcone, 98%, 4'–Chlorochalcone, 4'-Chlorochalcone, >98.0%(GC), 4'-Chlorochalcone 98%, 1-(4-Chlorophenyl)-3-phenylprop-2-en-1-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 250g.
(E)-1-(4-chlorophenyl)-3-phenylprop-2-en-1-one (CAS 956-02-5) is a chemical compound with the molecular formula C15H11ClO and a molecular weight of 242.70 g/mol. IUPAC name: (E)-1-(4-chlorophenyl)-3-phenylprop-2-en-1-one. InChIKey: HIINIOLNGCQCSM-IZZDOVSWSA-N.
| Molecular formula | C15H11ClO |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | (E)-1-(4-chlorophenyl)-3-phenylprop-2-en-1-one |
| InChIKey | HIINIOLNGCQCSM-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)