Products 2279124-14-8
CAS 2279124-14-8 is the registry number for 4-Benzyloxy-1-chloro-2-ethynyl-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-chloro-2-ethynyl-4-phenylmethoxybenzene (CAS 2279124-14-8) is a chemical compound with the molecular formula C15H11ClO and a molecular weight of 242.70 g/mol. IUPAC name: 1-chloro-2-ethynyl-4-phenylmethoxybenzene. InChIKey: RXOQLMMRIHGUJB-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 1-chloro-2-ethynyl-4-phenylmethoxybenzene |
| InChIKey | RXOQLMMRIHGUJB-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=CC(=C1)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)