Products 82102-37-2

CAS 82102-37-2 appears in our catalog under these names: 9-Methylfluorene-9-carbonyl chloride, 95+%, 9-Methylfluorene-9-carbonyl chloride, 98+%, 9-METHYL-9H-FLUORENE-9-CARBONYL CHLORIDE. Offered by: AmBeed, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 1g, 5g, 25G.

Structural formula: {0} (CAS {1})

9-methylfluorene-9-carbonyl chloride (CAS 82102-37-2) is a chemical compound with the molecular formula C15H11ClO and a molecular weight of 242.70 g/mol. IUPAC name: 9-methylfluorene-9-carbonyl chloride. InChIKey: ZQYOOHGEBHBNTP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11ClO
Molecular weight242.70 g/mol
IUPAC name9-methylfluorene-9-carbonyl chloride
InChIKeyZQYOOHGEBHBNTP-UHFFFAOYSA-N
SMILESCC1(C2=CC=CC=C2C3=CC=CC=C31)C(=O)Cl

Computed by PubChem (NCBI)