CAS 82102-37-2 appears in our catalog under these names: 9-Methylfluorene-9-carbonyl chloride, 95+%, 9-Methylfluorene-9-carbonyl chloride, 98+%, 9-METHYL-9H-FLUORENE-9-CARBONYL CHLORIDE. Offered by: AmBeed, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 1g, 5g, 25G.
9-methylfluorene-9-carbonyl chloride (CAS 82102-37-2) is a chemical compound with the molecular formula C15H11ClO and a molecular weight of 242.70 g/mol. IUPAC name: 9-methylfluorene-9-carbonyl chloride. InChIKey: ZQYOOHGEBHBNTP-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 9-methylfluorene-9-carbonyl chloride |
| InChIKey | ZQYOOHGEBHBNTP-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC=CC=C31)C(=O)Cl |
Computed by PubChem (NCBI)