CAS 22972-63-0 appears in our catalog under these names: 2–(3,5–Dimethoxyphenyl)–2–methylpropanenitrile, 2-(3,5-Dimethoxyphenyl)-2-methylpropanenitrile. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 10g.
2-(3,5-dimethoxyphenyl)-2-methylpropanenitrile (CAS 22972-63-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 2-(3,5-dimethoxyphenyl)-2-methylpropanenitrile. InChIKey: HUNVEDXBDXUTNF-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 2-(3,5-dimethoxyphenyl)-2-methylpropanenitrile |
| InChIKey | HUNVEDXBDXUTNF-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC(=CC(=C1)OC)OC |
Computed by PubChem (NCBI)