CAS 22996-23-2 appears in our catalog under these names: 4-Methoxy-2-nitrobenzyl alcohol, 95%, (4-Methoxy-2-nitrophenyl)methanol, 98%, 4-Methoxy-2-nitrobenzyl alcohol, 98%,RG, 98%,RG. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
(4-methoxy-2-nitrophenyl)methanol (CAS 22996-23-2) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: (4-methoxy-2-nitrophenyl)methanol. InChIKey: DDVFIARESYCFKS-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (4-methoxy-2-nitrophenyl)methanol |
| InChIKey | DDVFIARESYCFKS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)