Products 230292-85-0
CAS 230292-85-0 is the registry number for cis-Hinkiresinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1Z)-3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol (CAS 230292-85-0) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: 4-[(1Z)-3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol. InChIKey: VEAUNWQYYMXIRB-UTCJRWHESA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 4-[(1Z)-3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol |
| InChIKey | VEAUNWQYYMXIRB-UTCJRWHESA-N |
| SMILES | C=CC(/C=C\C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)