CAS 23046-02-8 appears in our catalog under these names: 5-Methoxybenzo[b]thiophene-2-carboxylic acid, 95%, 5–Methoxybenzo(b)thiophene–2–carboxylic acid, 5-Methoxybenzo[b]thiophene-2-carboxylic acid, 95%, 95%, 5-Methoxybenzo[b]thiophene-2-carboxylic acid, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
5-methoxy-1-benzothiophene-2-carboxylic acid (CAS 23046-02-8) is a chemical compound with the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. IUPAC name: 5-methoxy-1-benzothiophene-2-carboxylic acid. InChIKey: CSMSEXYPAWBSCB-UHFFFAOYSA-N.
| Molecular formula | C10H8O3S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 5-methoxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | CSMSEXYPAWBSCB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)