CAS 82788-15-6 is the registry number for Methyl 5-hydroxybenzo[b]thiophene-2-carboxylate, 98+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-hydroxy-1-benzothiophene-2-carboxylate (CAS 82788-15-6) is a chemical compound with the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. IUPAC name: methyl 5-hydroxy-1-benzothiophene-2-carboxylate. InChIKey: SVTGSWWZGBGGJZ-UHFFFAOYSA-N.
| Molecular formula | C10H8O3S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | methyl 5-hydroxy-1-benzothiophene-2-carboxylate |
| InChIKey | SVTGSWWZGBGGJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=CC(=C2)O |
Computed by PubChem (NCBI)