CAS 314725-14-9 appears in our catalog under these names: Methyl 4-hydroxy-1-benzothiophene-6-carboxylate, 95%, Methyl 4–Hydroxy–1–benzothiophene–6–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
Methyl 4-hydroxy-1-benzothiophene-6-carboxylate (CAS 314725-14-9) is a chemical compound with the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. IUPAC name: methyl 4-hydroxy-1-benzothiophene-6-carboxylate. InChIKey: IRAYMNSJGYCOHV-UHFFFAOYSA-N.
| Molecular formula | C10H8O3S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | methyl 4-hydroxy-1-benzothiophene-6-carboxylate |
| InChIKey | IRAYMNSJGYCOHV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C=CSC2=C1)O |
Computed by PubChem (NCBI)