Products 88791-07-5
CAS 88791-07-5 appears in our catalog under these names: 7-Methoxybenzo[b]thiophene-2-carboxylic acid, 95%, 7-Methoxybenzo(b)thiophene-2-carboxylic acid, 97%, 7-Methoxybenzo[b]thiophene-2-carboxylic acid, 97%, 97%, 7-Methoxybenzo[b]thiophene-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
7-methoxy-1-benzothiophene-2-carboxylic acid (CAS 88791-07-5) is a chemical compound with the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. IUPAC name: 7-methoxy-1-benzothiophene-2-carboxylic acid. InChIKey: QJWNYHKOXLTWOA-UHFFFAOYSA-N.
| Molecular formula | C10H8O3S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 7-methoxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | QJWNYHKOXLTWOA-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1SC(=C2)C(=O)O |
Computed by PubChem (NCBI)