Products 23050-90-0
CAS 23050-90-0 is the registry number for 4-(Diethylamino)-2-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(diethylamino)-2-hydroxybenzoic acid (CAS 23050-90-0) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 4-(diethylamino)-2-hydroxybenzoic acid. InChIKey: IZYRYLLQDKRMKK-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-(diethylamino)-2-hydroxybenzoic acid |
| InChIKey | IZYRYLLQDKRMKK-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Diethylamino)-2-hydroxybenzoic acid, Benzoic acid, 4-(diethylamino)-2-hydroxy-, 4-Diethylaminosalicylic acid, 4-(Diethylamino)salicylic acid, 4-(diethylamino) salicylic acid, 4-(Diethylamino)-2-hydroxybenzoicacid, 4-(diethylamino)-2-hydroxy-benzoic acid, 4-(Diethylamino)-2-hydroxybenzoic acid #