CAS 2305202-68-8 is the registry number for (1R,2R)-Ethyl 2-aminocyclopentanecarboxylate hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Trans-ethyl (1R,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride (CAS 2305202-68-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: RYBMXCZWUCHLJB-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | RYBMXCZWUCHLJB-ZJLYAJKPSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@H]1N.Cl |
Computed by PubChem (NCBI)