Products 2306217-11-6
CAS 2306217-11-6 is the registry number for Hydroxyvarenicline N-Oxide. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 10mg.
8-oxido-5,14-diaza-8-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),7,10-tetraen-6-one (CAS 2306217-11-6) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: 8-oxido-5,14-diaza-8-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),7,10-tetraen-6-one. InChIKey: BGRLRIWUHJXGSK-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 8-oxido-5,14-diaza-8-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),7,10-tetraen-6-one |
| InChIKey | BGRLRIWUHJXGSK-UHFFFAOYSA-N |
| SMILES | C1C2CNCC1C3=CC4=C(C=C23)NC(=O)C=[N+]4[O-] |
Computed by PubChem (NCBI)