Products 2306246-14-8
CAS 2306246-14-8 is the registry number for (3R,4R)-3-Fluoro-1-methylpiperidin-4-amine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(3R,4R)-3-fluoro-1-methylpiperidin-4-amine;dihydrochloride (CAS 2306246-14-8) is a chemical compound with the molecular formula C6H15Cl2FN2 and a molecular weight of 205.10 g/mol. IUPAC name: (3R,4R)-3-fluoro-1-methylpiperidin-4-amine;dihydrochloride. InChIKey: OQEKNKNLDNWJGD-BNTLRKBRSA-N.
| Molecular formula | C6H15Cl2FN2 |
|---|---|
| Molecular weight | 205.10 g/mol |
| IUPAC name | (3R,4R)-3-fluoro-1-methylpiperidin-4-amine;dihydrochloride |
| InChIKey | OQEKNKNLDNWJGD-BNTLRKBRSA-N |
| SMILES | CN1CC[C@H]([C@@H](C1)F)N.Cl.Cl |
Computed by PubChem (NCBI)