CAS 2306248-46-2 appears in our catalog under these names: O1-tert-butyl o2-ethyl (2s,5r)-5-aminopiperidine-1,2-dicarboxylate, 97%, O1-tert-butyl O2-ethyl (2S,5R)-5-aminopiperidine-1,2-dicarboxylate, 95%, 95%, 1-(tert-Butyl) 2-ethyl (2S,5R)-5-aminopiperidine-1,2-dicarboxylate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 2-O-ethyl (2S,5R)-5-aminopiperidine-1,2-dicarboxylate (CAS 2306248-46-2) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S,5R)-5-aminopiperidine-1,2-dicarboxylate. InChIKey: CVMRVIPMDLABQQ-ZJUUUORDSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S,5R)-5-aminopiperidine-1,2-dicarboxylate |
| InChIKey | CVMRVIPMDLABQQ-ZJUUUORDSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@H](CN1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)