Products 2361925-80-4
CAS 2361925-80-4 is the registry number for O1-tert-Butyl O2-ethyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-ethyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate (CAS 2361925-80-4) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate. InChIKey: CVMRVIPMDLABQQ-UWVGGRQHSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate |
| InChIKey | CVMRVIPMDLABQQ-UWVGGRQHSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H](CN1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)