CAS 2411590-87-7 appears in our catalog under these names: (2R,5S)-1-Boc-5-aminopiperidine-2-carboxylic acid ethyl ester, 97%, 97%, (2R,5S)-1-tert-Butyl 2-ethyl 5-aminopiperidine-1,2-dicarboxylate, 99.42%, (2R,5S)-1-tert-Butyl 2-ethyl 5-aminopiperidine-1,2-dicarboxylate, 98%, 1-(tert-Butyl) 2-ethyl (2R,5S)-5-aminopiperidine-1,2-dicarboxylate, 95%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 10g, 500 mg, 5 g.
1-O-tert-butyl 2-O-ethyl (2R,5S)-5-aminopiperidine-1,2-dicarboxylate (CAS 2411590-87-7) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-aminopiperidine-1,2-dicarboxylate. InChIKey: CVMRVIPMDLABQQ-VHSXEESVSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-aminopiperidine-1,2-dicarboxylate |
| InChIKey | CVMRVIPMDLABQQ-VHSXEESVSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](CN1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)