Products 2306249-53-4
CAS 2306249-53-4 is the registry number for methyl (2R,4S)-4-sulfanylpyrrolidine-2-carboxylate,hydrochloride. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2R,4S)-4-sulfanylpyrrolidine-2-carboxylate;hydrochloride (CAS 2306249-53-4) is a chemical compound with the molecular formula C6H12ClNO2S and a molecular weight of 197.68 g/mol. IUPAC name: methyl (2R,4S)-4-sulfanylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: FRPQUTPXKLXQNI-UYXJWNHNSA-N.
| Molecular formula | C6H12ClNO2S |
|---|---|
| Molecular weight | 197.68 g/mol |
| IUPAC name | methyl (2R,4S)-4-sulfanylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | FRPQUTPXKLXQNI-UYXJWNHNSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1)S.Cl |
Computed by PubChem (NCBI)