CAS 2306263-17-0 is the registry number for 4-Chloro-6-(tetrahydro-2H-pyran-4-yl)thieno[3,2-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-(oxan-4-yl)thieno[3,2-d]pyrimidine (CAS 2306263-17-0) is a chemical compound with the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. IUPAC name: 4-chloro-6-(oxan-4-yl)thieno[3,2-d]pyrimidine. InChIKey: DQDMPACXKGIBRG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2OS |
|---|---|
| Molecular weight | 254.74 g/mol |
| IUPAC name | 4-chloro-6-(oxan-4-yl)thieno[3,2-d]pyrimidine |
| InChIKey | DQDMPACXKGIBRG-UHFFFAOYSA-N |
| SMILES | C1COCCC1C2=CC3=C(S2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)