Products 2306264-03-7
CAS 2306264-03-7 is the registry number for 6-tert-butylthieno[3,2-d]pyrimidine-4-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-tert-butylthieno[3,2-d]pyrimidine-4-carboxylic acid (CAS 2306264-03-7) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 6-tert-butylthieno[3,2-d]pyrimidine-4-carboxylic acid. InChIKey: KOOKNEIMTKIQAM-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 6-tert-butylthieno[3,2-d]pyrimidine-4-carboxylic acid |
| InChIKey | KOOKNEIMTKIQAM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(S1)C(=NC=N2)C(=O)O |
Computed by PubChem (NCBI)