CAS 2306276-57-1 is the registry number for 2-(Benzo[b]thiophen-4-yl)-2,6-diazaspiro[3.3]heptane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-benzothiophen-4-yl)-2,6-diazaspiro[3.3]heptane (CAS 2306276-57-1) is a chemical compound with the molecular formula C13H14N2S and a molecular weight of 230.33 g/mol. IUPAC name: 2-(1-benzothiophen-4-yl)-2,6-diazaspiro[3.3]heptane. InChIKey: MOPBOWGVNFTBBA-UHFFFAOYSA-N.
| Molecular formula | C13H14N2S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | 2-(1-benzothiophen-4-yl)-2,6-diazaspiro[3.3]heptane |
| InChIKey | MOPBOWGVNFTBBA-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)C3=C4C=CSC4=CC=C3 |
Computed by PubChem (NCBI)