CAS 72324-66-4 appears in our catalog under these names: 1-Phenyl-4,5,6,7-tetrahydro-1h-benzimidazole-2-thiol, 95%, 1-phenyl-2,3,4,5,6,7-hexahydro-1H-1,3-benzodiazole-2-thione, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-phenyl-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione (CAS 72324-66-4) is a chemical compound with the molecular formula C13H14N2S and a molecular weight of 230.33 g/mol. IUPAC name: 3-phenyl-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione. InChIKey: OUQLDCQVKASCIK-UHFFFAOYSA-N.
| Molecular formula | C13H14N2S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | 3-phenyl-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione |
| InChIKey | OUQLDCQVKASCIK-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)NC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)