CAS 5955-39-5 appears in our catalog under these names: 3-Phenyl-1,4-diazaspiro[4.4]non-3-ene-2-thione, 90%, 3–Phenyl–1,4–diazaspiro(4·4)non–3–ene–2–thione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 500mg.
3-phenyl-1,4-diazaspiro[4.4]non-3-ene-2-thione (CAS 5955-39-5) is a chemical compound with the molecular formula C13H14N2S and a molecular weight of 230.33 g/mol. IUPAC name: 3-phenyl-1,4-diazaspiro[4.4]non-3-ene-2-thione. InChIKey: QJHLSXXGFICROR-UHFFFAOYSA-N.
| Molecular formula | C13H14N2S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | 3-phenyl-1,4-diazaspiro[4.4]non-3-ene-2-thione |
| InChIKey | QJHLSXXGFICROR-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)NC(=S)C(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)