CAS 879350-77-3 appears in our catalog under these names: 4-(2,3-Dihydro-1h-inden-5-yl)-5-methyl-1,3-thiazol-2-amine, 95%, 4-(2,3-Dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
4-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine (CAS 879350-77-3) is a chemical compound with the molecular formula C13H14N2S and a molecular weight of 230.33 g/mol. IUPAC name: 4-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine. InChIKey: PIHSKMPOPWHJCA-UHFFFAOYSA-N.
| Molecular formula | C13H14N2S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | 4-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine |
| InChIKey | PIHSKMPOPWHJCA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C2=CC3=C(CCC3)C=C2 |
Computed by PubChem (NCBI)