CAS 2306413-51-2 is the registry number for Juncatrin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-ethynyl-1,7-dimethyl-9,10-dihydrophenanthrene-2,6-diol (CAS 2306413-51-2) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: 8-ethynyl-1,7-dimethyl-9,10-dihydrophenanthrene-2,6-diol. InChIKey: KLMPTWHNIJPCCY-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 8-ethynyl-1,7-dimethyl-9,10-dihydrophenanthrene-2,6-diol |
| InChIKey | KLMPTWHNIJPCCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1CCC3=C(C(=C(C=C32)O)C)C#C)O |
Computed by PubChem (NCBI)