Products 2307737-83-1
CAS 2307737-83-1 appears in our catalog under these names: 7-bromo-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride, 98%, 98%, 7-BROMOCHROMAN-4-AMINE HYDROCHLORIDE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2307737-83-1) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: BVJCAWWHYBICLV-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | BVJCAWWHYBICLV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC(=C2)Br.Cl |
Computed by PubChem (NCBI)