CAS 1349718-53-1 appears in our catalog under these names: 3-(4-Bromophenyl)oxetan-3-amine hydrochloride, 95%, 3-(4-Bromophenyl)oxetan-3-amine hydrochloride, 3-(4-Bromophenyl)oxetan-3-amine hydrochloride 97%, 3-(4-bromophenyl)oxetan-3-amine hydrochloride, 97%, 97%, 3-(4-Bromophenyl)oxetan-3-amine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg, 5g, 500mg.
3-(4-bromophenyl)oxetan-3-amine;hydrochloride (CAS 1349718-53-1) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 3-(4-bromophenyl)oxetan-3-amine;hydrochloride. InChIKey: DKZUAEMOFJABIQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | 3-(4-bromophenyl)oxetan-3-amine;hydrochloride |
| InChIKey | DKZUAEMOFJABIQ-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)