Products 2565794-06-9
CAS 2565794-06-9 appears in our catalog under these names: (S)-7-Bromochroman-4-amine hydrochloride 95% HPLC, (S)-7-Bromochroman-4-amine hydrochloride, 95% HPLC, 95% HPLC, (S)-7-Bromochroman-4-amine hydrochloride, 95% HPLC. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4S)-7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2565794-06-9) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: (4S)-7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: BVJCAWWHYBICLV-QRPNPIFTSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | (4S)-7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | BVJCAWWHYBICLV-QRPNPIFTSA-N |
| SMILES | C1COC2=C([C@H]1N)C=CC(=C2)Br.Cl |
Computed by PubChem (NCBI)