CAS 1810074-69-1 appears in our catalog under these names: (R)-8-Bromochroman-4-amine hydrochloride, 95%, (R)–8–Bromochroman–4–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(4R)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1810074-69-1) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: (4R)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: GQVQWQSPIBHZSG-DDWIOCJRSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | (4R)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | GQVQWQSPIBHZSG-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=CC=C2Br.Cl |
Computed by PubChem (NCBI)