CAS 23094-96-4 appears in our catalog under these names: 3-Bromo-4-methoxybenzenesulfonyl chloride, 97% , 3-Bromo-4-methoxybenzenesulfonyl chloride, 97%, 3-Bromo-4-methoxybenzene-1-sulfonyl chloride 98%. Offered by: Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g, 250mg.
3-bromo-4-methoxybenzenesulfonyl chloride (CAS 23094-96-4) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 3-bromo-4-methoxybenzenesulfonyl chloride. InChIKey: LTVLATJRJIBHDR-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 3-bromo-4-methoxybenzenesulfonyl chloride |
| InChIKey | LTVLATJRJIBHDR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)