CAS 1215295-91-2 appears in our catalog under these names: 4-bromo-3-methoxybenzenesulfonyl chloride, 4-Bromo-3-methoxybenzene-1-sulfonyl chloride 95%, 4-Bromo-3-methoxybenzenesulfonyl chloride, 98%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 100g.
4-bromo-3-methoxybenzenesulfonyl chloride (CAS 1215295-91-2) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 4-bromo-3-methoxybenzenesulfonyl chloride. InChIKey: APCCBOUSWYTPJQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 4-bromo-3-methoxybenzenesulfonyl chloride |
| InChIKey | APCCBOUSWYTPJQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)