Products 1261776-39-9

CAS 1261776-39-9 appears in our catalog under these names: 3-Bromo-5-methoxybenzene-1-sulfonyl chloride, 3-Bromo-5-methoxybenzene-1-sulfonyl chloride 95%, 3-Bromo-5-methoxybenzene-1-sulfonyl chloride, 95%, 95%, 3-Bromo-5-methoxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg, 500mg, 2.5g, 5g.

Structural formula: {0} (CAS {1})

3-bromo-5-methoxybenzenesulfonyl chloride (CAS 1261776-39-9) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 3-bromo-5-methoxybenzenesulfonyl chloride. InChIKey: NTCPGLAJHCYHGG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrClO3S
Molecular weight285.54 g/mol
IUPAC name3-bromo-5-methoxybenzenesulfonyl chloride
InChIKeyNTCPGLAJHCYHGG-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)