Products 2309448-62-0
CAS 2309448-62-0 is the registry number for 2-(3-{((tert-Butoxy)carbonyl)amino}adamantan-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]acetic acid (CAS 2309448-62-0) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]acetic acid. InChIKey: NTKNKGUKHPYHTQ-UHFFFAOYSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]acetic acid |
| InChIKey | NTKNKGUKHPYHTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC3CC(C1)CC(C3)(C2)CC(=O)O |
Computed by PubChem (NCBI)