Products 2311864-74-9
CAS 2311864-74-9 is the registry number for 4-BENZYL 1-(TERT-BUTYL) (R)-2-((R)-1-HYDROXYETHYL)PIPERAZINE-1,4-DICARBOXYLATE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-O-benzyl 1-O-tert-butyl (2R)-2-[(1R)-1-hydroxyethyl]piperazine-1,4-dicarboxylate (CAS 2311864-74-9) is a chemical compound with the molecular formula C19H28N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl (2R)-2-[(1R)-1-hydroxyethyl]piperazine-1,4-dicarboxylate. InChIKey: LTXNDRMMTRTOJG-GDBMZVCRSA-N.
| Molecular formula | C19H28N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl (2R)-2-[(1R)-1-hydroxyethyl]piperazine-1,4-dicarboxylate |
| InChIKey | LTXNDRMMTRTOJG-GDBMZVCRSA-N |
| SMILES | C[C@H]([C@H]1CN(CCN1C(=O)OC(C)(C)C)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)