CAS 23132-52-7 appears in our catalog under these names: 1-tert-Butyl-3-nitrobenzene, 95%, 1–Tert–Butyl–3–Nitrobenzene, 1-tert-Butyl-3-nitrobenzene, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g.
1-tert-butyl-3-nitrobenzene (CAS 23132-52-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 1-tert-butyl-3-nitrobenzene. InChIKey: ZKRDQLBHUZNPGZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 1-tert-butyl-3-nitrobenzene |
| InChIKey | ZKRDQLBHUZNPGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)