CAS 23146-07-8 is the registry number for Dyphylline Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethyl-7-(oxiran-2-ylmethyl)purine-2,6-dione (CAS 23146-07-8) is a chemical compound with the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. IUPAC name: 1,3-dimethyl-7-(oxiran-2-ylmethyl)purine-2,6-dione. InChIKey: JNGNWSCREXDRBJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 1,3-dimethyl-7-(oxiran-2-ylmethyl)purine-2,6-dione |
| InChIKey | JNGNWSCREXDRBJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC3CO3 |
Computed by PubChem (NCBI)