CAS 72448-59-0 is the registry number for 2',5'-Dideoxyinosine. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg.
9-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-1H-purin-6-one (CAS 72448-59-0) is a chemical compound with the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. IUPAC name: 9-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-1H-purin-6-one. InChIKey: BGYISLAFYPDORJ-DSYKOEDSSA-N.
| Molecular formula | C10H12N4O3 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 9-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-1H-purin-6-one |
| InChIKey | BGYISLAFYPDORJ-DSYKOEDSSA-N |
| SMILES | C[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C2N=CNC3=O)O |
Computed by PubChem (NCBI)