CAS 82593-41-7 is the registry number for 5,6-Diamino-1-(2-furanylmethyl)-3-methyl-2,4(1H,3H)-pyrimidinedione. Offered by: TRC. Available pack sizes: 500mg.
5,6-diamino-1-(furan-2-ylmethyl)-3-methylpyrimidine-2,4-dione (CAS 82593-41-7) is a chemical compound with the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. IUPAC name: 5,6-diamino-1-(furan-2-ylmethyl)-3-methylpyrimidine-2,4-dione. InChIKey: VSHHHMTVOVUEIM-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 5,6-diamino-1-(furan-2-ylmethyl)-3-methylpyrimidine-2,4-dione |
| InChIKey | VSHHHMTVOVUEIM-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(N(C1=O)CC2=CC=CO2)N)N |
Computed by PubChem (NCBI)