CAS 42372-66-7 is the registry number for Carbazochrome Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
(3,5-dihydroxy-1-methyl-2,3-dihydroindol-6-yl)iminourea (CAS 42372-66-7) is a chemical compound with the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. IUPAC name: (3,5-dihydroxy-1-methyl-2,3-dihydroindol-6-yl)iminourea. InChIKey: MLPQKUXROCKTSE-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | (3,5-dihydroxy-1-methyl-2,3-dihydroindol-6-yl)iminourea |
| InChIKey | MLPQKUXROCKTSE-UHFFFAOYSA-N |
| SMILES | CN1CC(C2=CC(=C(C=C21)N=NC(=O)N)O)O |
Computed by PubChem (NCBI)